3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid
Modify Date: 2026-09-09 21:31:56
![3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid Structure](https://www.chemsrc.com/extcaspic/302/2172211-05-9.png)
3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid structure
|
Common Name | 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2172211-05-9 | Molecular Weight | 476.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H25FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H25FN2O5 |
|---|---|
| Molecular Weight | 476.5 |
| InChIKey | ISOHJVBQOFDRPT-UHFFFAOYSA-N |
| SMILES | CCC(CC(=O)O)NC(=O)c1cccc(F)c1NC(=O)OCC1c2ccccc2-c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid? |
| A: CAS number of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid is 2172211-05-9. |
| Q: What is the molecular formula of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid? |
| A: Molecular formula of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid is C27H25FN2O5. |
| Q: What is the Chinese name of 2172211-05-9? |
| A: Chinese name of 2172211-05-9 is 2172211-05-9. |
| Q: What is the molecular weight of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid? |
| A: Molecular weight of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid is 476.5. |
| Q: What is the SMILES notation of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid? |
| A: SMILES notation of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid is CCC(CC(=O)O)NC(=O)c1cccc(F)c1NC(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the InChIKey of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid? |
| A: InChIKey of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid is ISOHJVBQOFDRPT-UHFFFAOYSA-N. |
| Q: What is the English name of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid? |
| A: The English name of 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid is 3-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-fluorophenyl]formamido}pentanoic acid. |