(4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride
Modify Date: 2026-08-17 12:01:55
(4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride structure
|
Common Name | (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2172226-82-1 | Molecular Weight | 236.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H9FN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H9FN2O4S |
|---|---|
| Molecular Weight | 236.22 |
| InChIKey | KWBPBDIVYGERGZ-UHFFFAOYSA-N |
| SMILES | COc1ncnc(OC)c1CS(=O)(=O)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride? |
| A: InChIKey of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride is KWBPBDIVYGERGZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride? |
| A: Molecular formula of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride is C7H9FN2O4S. |
| Q: What is the molecular weight of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride? |
| A: Molecular weight of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride is 236.22. |
| Q: What is the Chinese name of 2172226-82-1? |
| A: Chinese name of 2172226-82-1 is 2172226-82-1. |
| Q: What is the English name of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride? |
| A: The English name of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride is (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride. |
| Q: What is the CAS number of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride? |
| A: CAS number of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride is 2172226-82-1. |
| Q: What is the SMILES notation of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride? |
| A: SMILES notation of (4,6-Dimethoxypyrimidin-5-yl)methanesulfonyl fluoride is COc1ncnc(OC)c1CS(=O)(=O)F. |