Propan-2-yl 4-(pyrrolidin-2-yl)benzoate
Modify Date: 2026-07-01 19:18:00
Propan-2-yl 4-(pyrrolidin-2-yl)benzoate structure
|
Common Name | Propan-2-yl 4-(pyrrolidin-2-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 2172246-85-2 | Molecular Weight | 233.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propan-2-yl 4-(pyrrolidin-2-yl)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19NO2 |
|---|---|
| Molecular Weight | 233.31 |
| InChIKey | VVHKCUZSBRAZPI-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)c1ccc(C2CCCN2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate? |
| A: SMILES notation of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate is CC(C)OC(=O)c1ccc(C2CCCN2)cc1. |
| Q: What is the English name of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate? |
| A: The English name of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate is Propan-2-yl 4-(pyrrolidin-2-yl)benzoate. |
| Q: What is the InChIKey of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate? |
| A: InChIKey of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate is VVHKCUZSBRAZPI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate? |
| A: Molecular formula of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate is C14H19NO2. |
| Q: What is the Chinese name of 2172246-85-2? |
| A: Chinese name of 2172246-85-2 is 2172246-85-2. |
| Q: What is the molecular weight of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate? |
| A: Molecular weight of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate is 233.31. |
| Q: What is the CAS number of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate? |
| A: CAS number of Propan-2-yl 4-(pyrrolidin-2-yl)benzoate is 2172246-85-2. |