5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid structure
|
Common Name | 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2172247-72-0 | Molecular Weight | 476.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H32N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H32N2O5 |
|---|---|
| Molecular Weight | 476.6 |
| InChIKey | NSYPEDYNTVXKGO-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCNC(=O)C1(NC(=O)OCC2c3ccccc3-c3ccccc32)CC2(CCC2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid? |
| A: The English name of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid is 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid. |
| Q: What is the Chinese name of 2172247-72-0? |
| A: Chinese name of 2172247-72-0 is 2172247-72-0. |
| Q: What is the InChIKey of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid? |
| A: InChIKey of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid is NSYPEDYNTVXKGO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid? |
| A: Molecular formula of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid is C28H32N2O5. |
| Q: What is the molecular weight of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid? |
| A: Molecular weight of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid is 476.6. |
| Q: What is the SMILES notation of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid? |
| A: SMILES notation of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid is O=C(O)CCCCNC(=O)C1(NC(=O)OCC2c3ccccc3-c3ccccc32)CC2(CCC2)C1. |
| Q: What is the CAS number of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid? |
| A: CAS number of 5-{[2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)spiro[3.3]heptan-2-yl]formamido}pentanoic acid is 2172247-72-0. |