{8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride
Modify Date: 2026-07-29 12:57:40
![{8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride Structure](https://www.chemsrc.com/extcaspic/354/2172275-23-7.png)
{8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride structure
|
Common Name | {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 2172275-23-7 | Molecular Weight | 265.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20FNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H20FNO3S |
|---|---|
| Molecular Weight | 265.35 |
| InChIKey | AEOIWAKIRUKMJK-UHFFFAOYSA-N |
| SMILES | CN1CCCC2(CCOC2CS(=O)(=O)F)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride? |
| A: The English name of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride is {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride. |
| Q: What is the CAS number of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride? |
| A: CAS number of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride is 2172275-23-7. |
| Q: What is the InChIKey of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride? |
| A: InChIKey of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride is AEOIWAKIRUKMJK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride? |
| A: Molecular weight of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride is 265.35. |
| Q: What is the molecular formula of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride? |
| A: Molecular formula of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride is C11H20FNO3S. |
| Q: What is the Chinese name of 2172275-23-7? |
| A: Chinese name of 2172275-23-7 is 2172275-23-7. |
| Q: What is the SMILES notation of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride? |
| A: SMILES notation of {8-Methyl-2-oxa-8-azaspiro[4.6]undecan-1-yl}methanesulfonyl fluoride is CN1CCCC2(CCOC2CS(=O)(=O)F)CC1. |