2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane
Modify Date: 2026-07-27 16:48:36
![2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane Structure](https://www.chemsrc.com/extcaspic/220/2172386-94-4.png)
2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane structure
|
Common Name | 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane | ||
|---|---|---|---|---|
| CAS Number | 2172386-94-4 | Molecular Weight | 225.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H23NO2 |
|---|---|
| Molecular Weight | 225.33 |
| InChIKey | UKUHEGYUNXKJTL-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CNC1(CCCOC1)OC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2172386-94-4? |
| A: Chinese name of 2172386-94-4 is 2172386-94-4. |
| Q: What is the InChIKey of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: InChIKey of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is UKUHEGYUNXKJTL-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: CAS number of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is 2172386-94-4. |
| Q: What is the molecular formula of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: Molecular formula of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is C13H23NO2. |
| Q: What is the SMILES notation of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: SMILES notation of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is C1CCC2(CC1)CNC1(CCCOC1)OC2. |
| Q: What is the molecular weight of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: Molecular weight of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is 225.33. |
| Q: What is the English name of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: The English name of 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is 2,7-Dioxa-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane. |