methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate
Modify Date: 2026-09-13 19:59:56
methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate structure
|
Common Name | methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2172433-69-9 | Molecular Weight | 273.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11N3O2S |
|---|---|
| Molecular Weight | 273.31 |
| InChIKey | QOVZEGROQLVXTD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(-c2c(C)ccc3[nH]ncc23)sn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate? |
| A: The English name of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate is methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate. |
| Q: What is the Chinese name of 2172433-69-9? |
| A: Chinese name of 2172433-69-9 is 2172433-69-9. |
| Q: What is the SMILES notation of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate? |
| A: SMILES notation of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate is COC(=O)c1cc(-c2c(C)ccc3[nH]ncc23)sn1. |
| Q: What is the InChIKey of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate? |
| A: InChIKey of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate is QOVZEGROQLVXTD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate? |
| A: Molecular formula of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate is C13H11N3O2S. |
| Q: What is the CAS number of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate? |
| A: CAS number of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate is 2172433-69-9. |
| Q: What is the molecular weight of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate? |
| A: Molecular weight of methyl 5-(5-methyl-1H-indazol-4-yl)-1,2-thiazole-3-carboxylate is 273.31. |