7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane
Modify Date: 2025-09-06 17:46:51
![7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane Structure](https://www.chemsrc.com/extcaspic/089/2172449-06-6.png)
7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane structure
|
Common Name | 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane | ||
|---|---|---|---|---|
| CAS Number | 2172449-06-6 | Molecular Weight | 243.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21NO2S |
|---|---|
| Molecular Weight | 243.37 |
| InChIKey | UWQUBPFVWRTTEE-UHFFFAOYSA-N |
| SMILES | C1CC2(CCO1)CNC1(CCSCC1)OC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2172449-06-6? |
| A: Chinese name of 2172449-06-6 is 2172449-06-6. |
| Q: What is the InChIKey of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: InChIKey of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is UWQUBPFVWRTTEE-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: SMILES notation of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is C1CC2(CCO1)CNC1(CCSCC1)OC2. |
| Q: What is the molecular formula of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: Molecular formula of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is C12H21NO2S. |
| Q: What is the CAS number of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: CAS number of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is 2172449-06-6. |
| Q: What is the English name of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: The English name of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane. |
| Q: What is the molecular weight of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane? |
| A: Molecular weight of 7,12-Dioxa-3-thia-16-azadispiro[5.2.5^{9}.2^{6}]hexadecane is 243.37. |