2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine
Modify Date: 2025-11-06 10:53:46
![2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine Structure](https://www.chemsrc.com/extcaspic/004/2172487-77-1.png)
2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine structure
|
Common Name | 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 2172487-77-1 | Molecular Weight | 236.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H24N4 |
|---|---|
| Molecular Weight | 236.36 |
| InChIKey | RXPGBFQCDCVALF-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)n1nnc(CCN)c1CC1CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2172487-77-1? |
| A: Chinese name of 2172487-77-1 is 2172487-77-1. |
| Q: What is the molecular weight of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine? |
| A: Molecular weight of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine is 236.36. |
| Q: What is the CAS number of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine? |
| A: CAS number of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine is 2172487-77-1. |
| Q: What is the SMILES notation of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine? |
| A: SMILES notation of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine is CC(C)C(C)n1nnc(CCN)c1CC1CC1. |
| Q: What is the InChIKey of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine? |
| A: InChIKey of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine is RXPGBFQCDCVALF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine? |
| A: Molecular formula of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine is C13H24N4. |
| Q: What is the English name of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine? |
| A: The English name of 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine is 2-[5-(cyclopropylmethyl)-1-(3-methylbutan-2-yl)-1H-1,2,3-triazol-4-yl]ethan-1-amine. |