3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol
Modify Date: 2026-06-26 16:00:35
![3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol Structure](https://www.chemsrc.com/extcaspic/433/2172518-13-5.png)
3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol structure
|
Common Name | 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 2172518-13-5 | Molecular Weight | 250.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16F2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H16F2N4O2 |
|---|---|
| Molecular Weight | 250.25 |
| InChIKey | MRTJSUUFDLGQNK-UHFFFAOYSA-N |
| SMILES | COC(C)c1c(CN)nnn1CC(F)(F)CO |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2172518-13-5? |
| A: Chinese name of 2172518-13-5 is 2172518-13-5. |
| Q: What is the molecular weight of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol? |
| A: Molecular weight of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol is 250.25. |
| Q: What is the InChIKey of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol? |
| A: InChIKey of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol is MRTJSUUFDLGQNK-UHFFFAOYSA-N. |
| Q: What is the English name of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol? |
| A: The English name of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol is 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol. |
| Q: What is the molecular formula of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol? |
| A: Molecular formula of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol is C9H16F2N4O2. |
| Q: What is the CAS number of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol? |
| A: CAS number of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol is 2172518-13-5. |
| Q: What is the SMILES notation of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol? |
| A: SMILES notation of 3-[4-(aminomethyl)-5-(1-methoxyethyl)-1H-1,2,3-triazol-1-yl]-2,2-difluoropropan-1-ol is COC(C)c1c(CN)nnn1CC(F)(F)CO. |