3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane
Modify Date: 2026-09-27 14:18:01
3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane structure
|
Common Name | 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane | ||
|---|---|---|---|---|
| CAS Number | 2172542-20-8 | Molecular Weight | 252.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H14BrNO3 |
|---|---|
| Molecular Weight | 252.11 |
| InChIKey | JVNBCTMCZIUKHP-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(Br)([N+](=O)[O-])C(C)(C)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane? |
| A: Molecular formula of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane is C8H14BrNO3. |
| Q: What is the Chinese name of 2172542-20-8? |
| A: Chinese name of 2172542-20-8 is 2172542-20-8. |
| Q: What is the CAS number of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane? |
| A: CAS number of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane is 2172542-20-8. |
| Q: What is the molecular weight of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane? |
| A: Molecular weight of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane is 252.11. |
| Q: What is the SMILES notation of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane? |
| A: SMILES notation of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane is CC1(C)CC(Br)([N+](=O)[O-])C(C)(C)O1. |
| Q: What is the English name of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane? |
| A: The English name of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane is 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane. |
| Q: What is the InChIKey of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane? |
| A: InChIKey of 3-Bromo-2,2,5,5-tetramethyl-3-nitrooxolane is JVNBCTMCZIUKHP-UHFFFAOYSA-N. |