2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid
Modify Date: 2026-07-15 14:08:48
2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid structure
|
Common Name | 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2172569-08-1 | Molecular Weight | 242.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H26O3 |
|---|---|
| Molecular Weight | 242.35 |
| InChIKey | PKQDJVDDGVJIBS-UHFFFAOYSA-N |
| SMILES | CCC(CC)(C(=O)O)C1(O)CC(C)CC(C)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid? |
| A: SMILES notation of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid is CCC(CC)(C(=O)O)C1(O)CC(C)CC(C)C1. |
| Q: What is the CAS number of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid? |
| A: CAS number of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid is 2172569-08-1. |
| Q: What is the Chinese name of 2172569-08-1? |
| A: Chinese name of 2172569-08-1 is 2172569-08-1. |
| Q: What is the InChIKey of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid? |
| A: InChIKey of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid is PKQDJVDDGVJIBS-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid? |
| A: The English name of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid is 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid. |
| Q: What is the molecular formula of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid? |
| A: Molecular formula of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid is C14H26O3. |
| Q: What is the molecular weight of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid? |
| A: Molecular weight of 2-Ethyl-2-(1-hydroxy-3,5-dimethylcyclohexyl)butanoic acid is 242.35. |