4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine
Modify Date: 2026-07-17 19:33:50
![4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine Structure](https://www.chemsrc.com/extcaspic/436/2172570-47-5.png)
4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine structure
|
Common Name | 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 2172570-47-5 | Molecular Weight | 238.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15ClN4 |
|---|---|
| Molecular Weight | 238.72 |
| InChIKey | AVMGAAVQLMVNGA-UHFFFAOYSA-N |
| SMILES | CCC(CC)Cn1ncc2c(Cl)ncnc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine? |
| A: The English name of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine is 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine. |
| Q: What is the InChIKey of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine? |
| A: InChIKey of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine is AVMGAAVQLMVNGA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine? |
| A: Molecular formula of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine is C11H15ClN4. |
| Q: What is the Chinese name of 2172570-47-5? |
| A: Chinese name of 2172570-47-5 is 2172570-47-5. |
| Q: What is the CAS number of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine? |
| A: CAS number of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine is 2172570-47-5. |
| Q: What is the molecular weight of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine? |
| A: Molecular weight of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine is 238.72. |
| Q: What is the SMILES notation of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine? |
| A: SMILES notation of 4-chloro-1-(2-ethylbutyl)-1H-pyrazolo[3,4-d]pyrimidine is CCC(CC)Cn1ncc2c(Cl)ncnc21. |