4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole
Modify Date: 2026-08-24 17:53:41
4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole structure
|
Common Name | 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole | ||
|---|---|---|---|---|
| CAS Number | 2172575-77-6 | Molecular Weight | 229.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16ClN3O |
|---|---|
| Molecular Weight | 229.71 |
| InChIKey | RREFLRMWFVIEPQ-UHFFFAOYSA-N |
| SMILES | COCc1c(CCl)nnn1C(C)C1CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole? |
| A: CAS number of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole is 2172575-77-6. |
| Q: What is the Chinese name of 2172575-77-6? |
| A: Chinese name of 2172575-77-6 is 2172575-77-6. |
| Q: What is the English name of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole? |
| A: The English name of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole is 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole. |
| Q: What is the molecular formula of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole? |
| A: Molecular formula of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole is C10H16ClN3O. |
| Q: What is the molecular weight of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole? |
| A: Molecular weight of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole is 229.71. |
| Q: What is the InChIKey of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole? |
| A: InChIKey of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole is RREFLRMWFVIEPQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole? |
| A: SMILES notation of 4-(chloromethyl)-1-(1-cyclopropylethyl)-5-(methoxymethyl)-1H-1,2,3-triazole is COCc1c(CCl)nnn1C(C)C1CC1. |