6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid
Modify Date: 2026-07-27 13:39:34
![6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/016/2172597-65-6.png)
6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid structure
|
Common Name | 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2172597-65-6 | Molecular Weight | 250.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14N2O2S |
|---|---|
| Molecular Weight | 250.32 |
| InChIKey | ATQZBFPBFLYBCJ-UHFFFAOYSA-N |
| SMILES | CCCc1nc(C(=O)O)c2cc(CC)sc2n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid? |
| A: InChIKey of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid is ATQZBFPBFLYBCJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid? |
| A: CAS number of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid is 2172597-65-6. |
| Q: What is the SMILES notation of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid? |
| A: SMILES notation of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid is CCCc1nc(C(=O)O)c2cc(CC)sc2n1. |
| Q: What is the molecular weight of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid? |
| A: Molecular weight of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid is 250.32. |
| Q: What is the Chinese name of 2172597-65-6? |
| A: Chinese name of 2172597-65-6 is 2172597-65-6. |
| Q: What is the molecular formula of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid? |
| A: Molecular formula of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid is C12H14N2O2S. |
| Q: What is the English name of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid? |
| A: The English name of 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid is 6-Ethyl-2-propylthieno[2,3-d]pyrimidine-4-carboxylic acid. |