8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid
Modify Date: 2026-01-04 22:50:50
8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid structure
|
Common Name | 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2172602-75-2 | Molecular Weight | 230.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18O5 |
|---|---|
| Molecular Weight | 230.26 |
| InChIKey | KJRPCJZOQIVZTD-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(=O)C(C)CC(C)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid? |
| A: CAS number of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid is 2172602-75-2. |
| Q: What is the InChIKey of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid? |
| A: InChIKey of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid is KJRPCJZOQIVZTD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2172602-75-2? |
| A: Chinese name of 2172602-75-2 is 2172602-75-2. |
| Q: What is the molecular weight of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid? |
| A: Molecular weight of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid is 230.26. |
| Q: What is the SMILES notation of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid? |
| A: SMILES notation of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid is COC(=O)CCC(=O)C(C)CC(C)C(=O)O. |
| Q: What is the English name of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid? |
| A: The English name of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid is 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid. |
| Q: What is the molecular formula of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid? |
| A: Molecular formula of 8-Methoxy-2,4-dimethyl-5,8-dioxooctanoic acid is C11H18O5. |