AZD9496 deacrylic acid phenol structure
|
Common Name | AZD9496 deacrylic acid phenol | ||
|---|---|---|---|---|
| CAS Number | 2173404-70-9 | Molecular Weight | 388.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AZD9496 deacrylic acid phenolAZD9496 deacrylic acid phenol is a fragment of target protein ligand of PROTAC ER Degrader-4 (HY-135309)[1]. |
| Name | 3,5-Difluoro-4-((1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenol |
|---|
| Description | AZD9496 deacrylic acid phenol is a fragment of target protein ligand of PROTAC ER Degrader-4 (HY-135309)[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Bin Yang, et al. Compounds and their use in treating cancer. WO2019123367A1. |
| Molecular Formula | C22H23F3N2O |
|---|---|
| Molecular Weight | 388.43 |
| InChIKey | UQFNAXIUJPIITK-XUSGNXJCSA-N |
| SMILES | CC1Cc2c([nH]c3ccccc23)C(c2c(F)cc(O)cc2F)N1CC(C)(C)F |