3-Hydroxycyclopentane-1,1-dicarboxylic acid diethyl ester structure
|
Common Name | 3-Hydroxycyclopentane-1,1-dicarboxylic acid diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 21736-07-2 | Molecular Weight | 230.25800 | |
| Density | 1.196 | Boiling Point | 292ºC | |
| Molecular Formula | C11H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103ºC | |
| Name | diethyl 3-hydroxycyclopentane-1,1-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196 |
|---|---|
| Boiling Point | 292ºC |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.25800 |
| Flash Point | 103ºC |
| Exact Mass | 230.11500 |
| PSA | 72.83000 |
| LogP | 0.64380 |
| Vapour Pressure | 0.000199mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | MLOZQIXOIZCXKB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCC(O)C1 |
| HS Code | 2918199090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,1-Cyclopentanedicarboxylicacid,3-hydroxy-,diethyl ester (8CI,9CI) |
| 3-Hydroxy-cyclopentane-1,1-dicarboxylic acid diethyl ester |
| 1,1-Cyclopentanedicarboxylicacid,3-hydroxy-,1,1-diethyl ester |
| 3-Hydroxycyclopentane-1,1-dicarboxylic acid diethyl ester |