methyl 2,2-bis(4-ethoxyphenyl)acetate structure
|
Common Name | methyl 2,2-bis(4-ethoxyphenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 21749-90-6 | Molecular Weight | 314.37600 | |
| Density | 1.095g/cm3 | Boiling Point | 433.1ºC at 760 mmHg | |
| Molecular Formula | C19H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.9ºC | |
| Name | methyl 2,2-bis(4-ethoxyphenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.095g/cm3 |
|---|---|
| Boiling Point | 433.1ºC at 760 mmHg |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.37600 |
| Flash Point | 188.9ºC |
| Exact Mass | 314.15200 |
| PSA | 44.76000 |
| LogP | 3.78890 |
| Vapour Pressure | 1.05E-07mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | GGNFRRXBHCNQNO-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(C(=O)OC)c2ccc(OCC)cc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4.4'-Diaethoxy-diphenylessigsaeure-methylester |