trimethyl(6-trimethylsilylhexa-1,3,5-triynyl)silane structure
|
Common Name | trimethyl(6-trimethylsilylhexa-1,3,5-triynyl)silane | ||
|---|---|---|---|---|
| CAS Number | 21752-86-3 | Molecular Weight | 218.44200 | |
| Density | 0.88g/cm3 | Boiling Point | 237.3ºC at 760 mmHg | |
| Molecular Formula | C12H18Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 81.2ºC | |
| Name | trimethyl(6-trimethylsilylhexa-1,3,5-triynyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.88g/cm3 |
|---|---|
| Boiling Point | 237.3ºC at 760 mmHg |
| Molecular Formula | C12H18Si2 |
| Molecular Weight | 218.44200 |
| Flash Point | 81.2ºC |
| Exact Mass | 218.09500 |
| LogP | 2.75140 |
| Vapour Pressure | 0.0694mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | WFRYFVIBFUVRKZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC#CC#C[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Me3SiC6SiMe3 |