2-(3,5-dimethoxy-4-phenylmethoxyphenyl)ethanamine,hydrochloride structure
|
Common Name | 2-(3,5-dimethoxy-4-phenylmethoxyphenyl)ethanamine,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2176-15-0 | Molecular Weight | 323.81400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,5-dimethoxy-4-phenylmethoxyphenyl)ethanamine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H22ClNO3 |
|---|---|
| Molecular Weight | 323.81400 |
| Exact Mass | 323.12900 |
| PSA | 53.71000 |
| LogP | 4.28630 |
| InChIKey | PIOBTAQJPUGKNW-UHFFFAOYSA-N |
| SMILES | COc1cc(CCN)cc(OC)c1OCc1ccccc1.Cl |
| HS Code | 2922299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-benzyloxy-3,5-dimethoxy-phenethylamine,hydrochloride |
| 4-Benzyloxy-3,5-dimethoxy-phenaethylamin,Hydrochlorid |