N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide
Modify Date: 2025-09-08 18:45:15
![N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide Structure](https://www.chemsrc.com/extcaspic/208/2176843-76-6.png)
N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide structure
|
Common Name | N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 2176843-76-6 | Molecular Weight | 242.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18N2O |
|---|---|
| Molecular Weight | 242.32 |
| InChIKey | CTPYLHCSETVNCY-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Nc1ccccc1N1CC2CCC1C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide? |
| A: CAS number of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide is 2176843-76-6. |
| Q: What is the molecular weight of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide? |
| A: Molecular weight of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide is 242.32. |
| Q: What is the English name of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide? |
| A: The English name of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide is N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide. |
| Q: What is the InChIKey of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide? |
| A: InChIKey of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide is CTPYLHCSETVNCY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide? |
| A: SMILES notation of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide is C=CC(=O)Nc1ccccc1N1CC2CCC1C2. |
| Q: What is the molecular formula of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide? |
| A: Molecular formula of N-(2-{2-azabicyclo[2.2.1]heptan-2-yl}phenyl)prop-2-enamide is C15H18N2O. |
| Q: What is the Chinese name of 2176843-76-6? |
| A: Chinese name of 2176843-76-6 is 2176843-76-6. |