Thiourea,N-(4-methoxyphenyl)-N'-2-pyridinyl- structure
|
Common Name | Thiourea,N-(4-methoxyphenyl)-N'-2-pyridinyl- | ||
|---|---|---|---|---|
| CAS Number | 21780-68-7 | Molecular Weight | 259.32700 | |
| Density | 1.33g/cm3 | Boiling Point | 407.4ºC at 760mmHg | |
| Molecular Formula | C13H13N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.2ºC | |
| Name | 1-(4-methoxyphenyl)-3-(2-pyridyl)-2-thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 407.4ºC at 760mmHg |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.32700 |
| Flash Point | 200.2ºC |
| Exact Mass | 259.07800 |
| PSA | 78.27000 |
| LogP | 3.04510 |
| Vapour Pressure | 7.57E-07mmHg at 25°C |
| Index of Refraction | 1.721 |
| InChIKey | PZCDNWLGSCLQCC-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(=S)Nc2ccccn2)cc1 |
| HS Code | 2933399090 |
|---|
|
~92%
Thiourea,N-(4-m... CAS#:21780-68-7 |
| Literature: Kumar; Singh; Pandeya Bollettino Chimico Farmaceutico, 2001 , vol. 140, # 4 p. 238 - 242 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4-methoxyphenyl)-3-pyridin-2-ylthiourea |