CID 78345885
Modify Date: 2026-08-31 02:19:14
CID 78345885 structure
|
Common Name | CID 78345885 | ||
|---|---|---|---|---|
| CAS Number | 218136-14-2 | Molecular Weight | 329.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 78345885 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18Cl2N4O |
|---|---|
| Molecular Weight | 329.2 |
| InChIKey | LSUXAVWNPLHEAG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NC1CCC2CNNC2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of CID 78345885? |
| A: Molecular formula of CID 78345885 is C14H18Cl2N4O. |
| Q: What is the CAS number of CID 78345885? |
| A: CAS number of CID 78345885 is 218136-14-2. |
| Q: What is the InChIKey of CID 78345885? |
| A: InChIKey of CID 78345885 is LSUXAVWNPLHEAG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 218136-14-2? |
| A: Chinese name of 218136-14-2 is 218136-14-2. |
| Q: What is the molecular weight of CID 78345885? |
| A: Molecular weight of CID 78345885 is 329.2. |
| Q: What is the SMILES notation of CID 78345885? |
| A: SMILES notation of CID 78345885 is O=C(Nc1ccc(Cl)c(Cl)c1)NC1CCC2CNNC2C1. |
| Q: What is the English name of CID 78345885? |
| A: The English name of CID 78345885 is CID 78345885. |