5-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-1,3-oxazolidin-2-one structure
|
Common Name | 5-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-1,3-oxazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 21820-81-5 | Molecular Weight | 272.34200 | |
| Density | 1.14g/cm3 | Boiling Point | 502.7ºC at 760mmHg | |
| Molecular Formula | C16H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.8ºC | |
| Name | 5-[2-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-1,3-oxazolidin-2-one |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 502.7ºC at 760mmHg |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.34200 |
| Flash Point | 257.8ºC |
| Exact Mass | 272.15200 |
| PSA | 45.06000 |
| LogP | 1.85210 |
| Vapour Pressure | 3.1E-10mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | LYYFGMMKROVOCX-UHFFFAOYSA-N |
| SMILES | O=C1NCC(CCN2CC=C(c3ccccc3)CC2)O1 |
| HS Code | 2934999090 |
|---|
|
~%
5-[2-(4-phenyl-... CAS#:21820-81-5 |
| Literature: Welstead Jr.; Helsley; Taylor; Turnbull; DaVanzo; Funderburk; Alphin Journal of Medicinal Chemistry, 1973 , vol. 16, # 10 p. 1129 - 1132 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |