diethyl 2-(butylcarbamoylamino)propanedioate structure
|
Common Name | diethyl 2-(butylcarbamoylamino)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 21823-92-7 | Molecular Weight | 274.31300 | |
| Density | 1.102g/cm3 | Boiling Point | 426.5ºC at 760 mmHg | |
| Molecular Formula | C12H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.7ºC | |
| Name | diethyl 2-(butylcarbamoylamino)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 426.5ºC at 760 mmHg |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.31300 |
| Flash Point | 211.7ºC |
| Exact Mass | 274.15300 |
| PSA | 93.73000 |
| LogP | 1.36230 |
| Vapour Pressure | 1.77E-07mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | FWJLWWJEKSDMSD-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)NC(C(=O)OCC)C(=O)OCC |
|
~89%
diethyl 2-(buty... CAS#:21823-92-7 |
| Literature: Miao, Chun-Bao; Dong, Chun-Ping; Zhang, Min; Ren, Wen-Long; Meng, Qi; Sun, Xiao-Qiang; Yang, Hai-Tao Journal of Organic Chemistry, 2013 , vol. 78, # 9 p. 4329 - 4340 |
|
~%
diethyl 2-(buty... CAS#:21823-92-7 |
| Literature: Perini,F.; Tieckelmann,H. Journal of Organic Chemistry, 1970 , vol. 35, p. 812 - 816 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Diethyl-N'-n-butylureidomalonat |