Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate
Modify Date: 2026-07-06 12:50:07
Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate structure
|
Common Name | Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 21837-98-9 | Molecular Weight | 202.01 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3F5NaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C3F5NaO3 |
|---|---|
| Molecular Weight | 202.01 |
| InChIKey | FLNIPCHTFOGFRA-UHFFFAOYSA-M |
| SMILES | O=C([O-])C(F)(F)OC(F)(F)F.[Na+] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate? |
| A: Molecular weight of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate is 202.01. |
| Q: What is the English name of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate? |
| A: The English name of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate is Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate. |
| Q: What is the SMILES notation of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate? |
| A: SMILES notation of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate is O=C([O-])C(F)(F)OC(F)(F)F.[Na+]. |
| Q: What is the CAS number of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate? |
| A: CAS number of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate is 21837-98-9. |
| Q: What is the Chinese name of 21837-98-9? |
| A: Chinese name of 21837-98-9 is 21837-98-9. |
| Q: What is the molecular formula of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate? |
| A: Molecular formula of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate is C3F5NaO3. |
| Q: What is the InChIKey of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate? |
| A: InChIKey of Sodium 2,2-difluoro-2-(trifluoromethoxy)acetate is FLNIPCHTFOGFRA-UHFFFAOYSA-M. |