2-Butyne-1,4-diol,1,4-bis(N-phenylcarbamate) structure
|
Common Name | 2-Butyne-1,4-diol,1,4-bis(N-phenylcarbamate) | ||
|---|---|---|---|---|
| CAS Number | 21840-67-5 | Molecular Weight | 324.33100 | |
| Density | 1.32g/cm3 | Boiling Point | 427.1ºC at 760mmHg | |
| Molecular Formula | C18H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.1ºC | |
| Name | 4-(phenylcarbamoyloxy)but-2-ynyl N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 427.1ºC at 760mmHg |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.33100 |
| Flash Point | 212.1ºC |
| Exact Mass | 324.11100 |
| PSA | 76.66000 |
| LogP | 3.63320 |
| Vapour Pressure | 1.68E-07mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | RULCWOHYYYFGED-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)OCC#CCOC(=O)Nc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~97%
2-Butyne-1,4-di... CAS#:21840-67-5 |
| Literature: Ramesh; Chandrasekaran Organic Letters, 2005 , vol. 7, # 22 p. 4947 - 4950 |
|
~%
2-Butyne-1,4-di... CAS#:21840-67-5 |
| Literature: Horino, Yoshikazu; Kimura, Masanari; Tanaka, Shuji; Okajima, Toshiya; Tamaru, Yoshinao Chemistry - A European Journal, 2003 , vol. 9, # 11 p. 2419 - 2438 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,4-bis-phenylcarbamoyloxy-but-2-yne |
| but-2-yne-1,4-diyl bis(phenylcarbamate) |
| 1,4-Bis-phenylcarbamoyloxy-but-2-in |