Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate)
Modify Date: 2026-08-10 23:16:45
Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate) structure
|
Common Name | Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate) | ||
|---|---|---|---|---|
| CAS Number | 21857-44-3 | Molecular Weight | 346.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14N2O7 |
|---|---|
| Molecular Weight | 346.29 |
| InChIKey | MMDLVIYEJLPTBP-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])c(CCOC(=O)c2ccc([N+](=O)[O-])cc2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate)? |
| A: The English name of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate) is Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate). |
| Q: What is the SMILES notation of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate)? |
| A: SMILES notation of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate) is COc1ccc([N+](=O)[O-])c(CCOC(=O)c2ccc([N+](=O)[O-])cc2)c1. |
| Q: What is the molecular weight of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate)? |
| A: Molecular weight of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate) is 346.29. |
| Q: What is the CAS number of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate)? |
| A: CAS number of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate) is 21857-44-3. |
| Q: What is the Chinese name of 21857-44-3? |
| A: Chinese name of 21857-44-3 is 21857-44-3. |
| Q: What is the molecular formula of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate)? |
| A: Molecular formula of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate) is C16H14N2O7. |
| Q: What is the InChIKey of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate)? |
| A: InChIKey of Benzeneethanol, 5-methoxy-2-nitro-, 1-(4-nitrobenzoate) is MMDLVIYEJLPTBP-UHFFFAOYSA-N. |