4,7-bis(4-chlorophenyl)-8,8-dimethyl-9-oxa-2,4-diazabicyclo[4.3.0]non-10-ene-3,5-dione structure
|
Common Name | 4,7-bis(4-chlorophenyl)-8,8-dimethyl-9-oxa-2,4-diazabicyclo[4.3.0]non-10-ene-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 21864-01-7 | Molecular Weight | 403.25900 | |
| Density | 1.47g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H16Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-bis(4-chlorophenyl)-6,6-dimethyl-1,5-dihydrofuro[2,3-d]pyrimidine-2,4-dione |
|---|
| Density | 1.47g/cm3 |
|---|---|
| Molecular Formula | C20H16Cl2N2O3 |
| Molecular Weight | 403.25900 |
| Exact Mass | 402.05400 |
| PSA | 64.09000 |
| LogP | 4.13550 |
| Index of Refraction | 1.677 |
| InChIKey | XOJYJWCPEGKOMJ-UHFFFAOYSA-N |
| SMILES | CC1(C)Oc2[nH]c(=O)n(-c3ccc(Cl)cc3)c(=O)c2C1c1ccc(Cl)cc1 |
|
~%
4,7-bis(4-chlor... CAS#:21864-01-7 |
| Literature: Campaigne,E. et al. Journal of Medicinal Chemistry, 1969 , vol. 12, # 2 p. 339 - 342 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |