7-(4-chlorophenyl)-4-(4-methoxyphenyl)-8,8-dimethyl-9-oxa-2,4-diazabicyclo[4.3.0]non-10-ene-3,5-dione structure
|
Common Name | 7-(4-chlorophenyl)-4-(4-methoxyphenyl)-8,8-dimethyl-9-oxa-2,4-diazabicyclo[4.3.0]non-10-ene-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 21864-02-8 | Molecular Weight | 398.84000 | |
| Density | 1.4g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H19ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-chlorophenyl)-3-(4-methoxyphenyl)-6,6-dimethyl-1,5-dihydrofuro[2,3-d]pyrimidine-2,4-dione |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.84000 |
| Exact Mass | 398.10300 |
| PSA | 73.32000 |
| LogP | 3.49070 |
| Index of Refraction | 1.657 |
| InChIKey | VVXYHJQVVOKHOZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-n2c(=O)[nH]c3c(c2=O)C(c2ccc(Cl)cc2)C(C)(C)O3)cc1 |
|
~%
7-(4-chlorophen... CAS#:21864-02-8 |
| Literature: Campaigne,E. et al. Journal of Medicinal Chemistry, 1969 , vol. 12, # 2 p. 339 - 342 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |