7-(4-chlorophenyl)-8,8-dimethyl-4-(4-methylphenyl)-9-oxa-2,4-diazabicyclo[4.3.0]non-10-ene-3,5-dione structure
|
Common Name | 7-(4-chlorophenyl)-8,8-dimethyl-4-(4-methylphenyl)-9-oxa-2,4-diazabicyclo[4.3.0]non-10-ene-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 21864-03-9 | Molecular Weight | 382.84000 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H19ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-chlorophenyl)-6,6-dimethyl-3-(p-tolyl)-5,6-dihydrofuro[2,3-d]pyrimidine-2,4(1H,3H)-dione |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Molecular Formula | C21H19ClN2O3 |
| Molecular Weight | 382.84000 |
| Exact Mass | 382.10800 |
| PSA | 64.09000 |
| LogP | 3.79050 |
| Index of Refraction | 1.661 |
| InChIKey | HBZYFFQJVSONDQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(=O)[nH]c3c(c2=O)C(c2ccc(Cl)cc2)C(C)(C)O3)cc1 |
|
~%
7-(4-chlorophen... CAS#:21864-03-9 |
| Literature: Campaigne,E. et al. Journal of Medicinal Chemistry, 1969 , vol. 12, # 2 p. 339 - 342 |