Methyl (10E,12Z)-10,12-octadecadienoate structure
|
Common Name | Methyl (10E,12Z)-10,12-octadecadienoate | ||
|---|---|---|---|---|
| CAS Number | 21870-97-3 | Molecular Weight | 294.472 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 376.1±11.0 °C at 760 mmHg | |
| Molecular Formula | C19H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 98.7±17.6 °C | |
Use of Methyl (10E,12Z)-10,12-octadecadienoate10(E),12(Z)-Conjugated linoleic acid methyl ester has been used as a standard in the quantification of 10(E),12(Z)-conjugated linoleic acid from L. plantarum culture samples. |
| Name | Methyl (10E,12Z)-10,12-octadecadienoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 376.1±11.0 °C at 760 mmHg |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.472 |
| Flash Point | 98.7±17.6 °C |
| Exact Mass | 294.255890 |
| PSA | 26.30000 |
| LogP | 7.64 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.465 |
| InChIKey | KMXSXYSNZMSDFK-UQGDGPGGSA-N |
| SMILES | CCCCCC=CC=CCCCCCCCCC(=O)OC |
| 10,12-octadecadienol |
| 10,12-Octadecadienoic acid, methyl ester, (10E,12Z)- |
| methyl 10-trans,12-cis-octadecadienoate |
| Methyl (10E,12Z)-octadeca-10,12-dienoate |
| 10E,12Z-conjugated linoleic acid methyl ester |
| Methyl (10E,12Z)-10,12-octadecadienoate |
| Me 10t,12c-CLA |
| methyl trans-10,cis-12-octadecadienoate |
| methyl trans,cis-10,12-octadecadienoate |
| 10,12-Octadecadien-1-ol |