2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester
Modify Date: 2026-06-30 11:17:23
![2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester Structure](https://www.chemsrc.com/extcaspic/237/2188159-75-1.png)
2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester structure
|
Common Name | 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2188159-75-1 | Molecular Weight | 430.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H15ClN2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H15ClN2O5S |
|---|---|
| Molecular Weight | 430.9 |
| InChIKey | RALRUSKRVSQZHX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc(-c2cn(S(=O)(=O)c3ccccc3)c3cc(Cl)ccc23)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2188159-75-1? |
| A: Chinese name of 2188159-75-1 is 2188159-75-1. |
| Q: What is the molecular weight of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester? |
| A: Molecular weight of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester is 430.9. |
| Q: What is the InChIKey of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester? |
| A: InChIKey of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester is RALRUSKRVSQZHX-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester? |
| A: Molecular formula of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester is C20H15ClN2O5S. |
| Q: What is the CAS number of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester? |
| A: CAS number of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester is 2188159-75-1. |
| Q: What is the SMILES notation of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester? |
| A: SMILES notation of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester is CCOC(=O)c1cnc(-c2cn(S(=O)(=O)c3ccccc3)c3cc(Cl)ccc23)o1. |
| Q: What is the English name of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester? |
| A: The English name of 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester is 2-[6-Chloro-1-(phenylsulfonyl)-1h-indol-3-yl]-5-oxazolecarboxylic acid ethyl ester. |