9H-Purin-6-amine,N-[(2-methoxy-1,4-cyclohexadien-1-yl)methyl]- structure
|
Common Name | 9H-Purin-6-amine,N-[(2-methoxy-1,4-cyclohexadien-1-yl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 21883-07-8 | Molecular Weight | 257.29100 | |
| Density | 1.38g/cm3 | Boiling Point | 422.2ºC at 760 mmHg | |
| Molecular Formula | C13H15N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.1ºC | |
| Name | N-[(2-methoxycyclohexa-1,4-dien-1-yl)methyl]-7H-purin-6-amine |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 422.2ºC at 760 mmHg |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.29100 |
| Flash Point | 209.1ºC |
| Exact Mass | 257.12800 |
| PSA | 75.72000 |
| LogP | 2.08830 |
| Vapour Pressure | 2.46E-07mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | KBRYNMAOXOFGDY-UHFFFAOYSA-N |
| SMILES | COC1=C(CNc2ncnc3nc[nH]c23)CC=CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |