Tricyclo[4.3.1.13,8]undecane-3-carboxylic acid structure
|
Common Name | Tricyclo[4.3.1.13,8]undecane-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 21898-91-9 | Molecular Weight | 194.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Homoadamantanecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18O2 |
|---|---|
| Molecular Weight | 194.27000 |
| Exact Mass | 194.13100 |
| PSA | 37.30000 |
| LogP | 2.67750 |
| InChIKey | ZWJPDTCMULYABF-UHFFFAOYSA-N |
| SMILES | O=C(O)C12CCC3CC(CC(C3)C1)C2 |
| HS Code | 2916209090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Tricyclo[4.3.1.13,8]undecane-3-carboxylic acid |
| 3-homoadamantanecarboxylate (3HAC) |