1,3-Dilinoleoyl-2-Oleoyl-glycerol structure
|
Common Name | 1,3-Dilinoleoyl-2-Oleoyl-glycerol | ||
|---|---|---|---|---|
| CAS Number | 2190-22-9 | Molecular Weight | 881.400 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 817.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C57H100O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.9±34.3 °C | |
Use of 1,3-Dilinoleoyl-2-Oleoyl-glycerol1,3-Linolein-2-Olein, a triglyceride, is an antileishmanial drug. 1,3-Linolein-2-Olein inhibits promatigotes of the parasite (IC50=0.079 ug/ml) and inhibits the growth of amastigotes (IC50= 40.03 ug/ml)[1]. |
| Name | 1,3-Dilinoleoyl-2-Oleoyl-glycerol |
|---|---|
| Synonym | More Synonyms |
| Description | 1,3-Linolein-2-Olein, a triglyceride, is an antileishmanial drug. 1,3-Linolein-2-Olein inhibits promatigotes of the parasite (IC50=0.079 ug/ml) and inhibits the growth of amastigotes (IC50= 40.03 ug/ml)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 817.3±65.0 °C at 760 mmHg |
| Molecular Formula | C57H100O6 |
| Molecular Weight | 881.400 |
| Flash Point | 302.9±34.3 °C |
| Exact Mass | 880.752014 |
| LogP | 22.68 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | UDQCIYKUZOQISE-SIBCJXFASA-N |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC |
| 1,3-Dilinoleoyl-2-Oleoyl-glycerol |
| 2-[(9Z)-9-Octadecenoyloxy]-1,3-propanediyl (9Z,12Z,9'Z,12'Z)bis(-9,12-octadecadienoate) |
| 2-[(9Z)-octadec-9-enoyloxy]propane-1,3-diyl (9Z,12Z,9'Z,12'Z)bis-octadeca-9,12-dienoate |
| 9,12-Octadecadienoic acid, 2-[[(9Z)-1-oxo-9-octadecen-1-yl]oxy]-1,3-propanediyl ester, (9Z,12Z,9'Z,12'Z)- |