Quino[2,3-b]acridine-7,14-dione,5,12-dihydro-2,9-dimethoxy- structure
|
Common Name | Quino[2,3-b]acridine-7,14-dione,5,12-dihydro-2,9-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 2190-64-9 | Molecular Weight | 372.37300 | |
| Density | 1.35g/cm3 | Boiling Point | 646.1ºC at 760 mmHg | |
| Molecular Formula | C22H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.5ºC | |
| Name | 2,9-dimethoxy-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 646.1ºC at 760 mmHg |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.37300 |
| Flash Point | 344.5ºC |
| Exact Mass | 372.11100 |
| PSA | 84.18000 |
| LogP | 3.69320 |
| Vapour Pressure | 1.4E-16mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | WKLOSXKZASUWLB-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c3cc4c(=O)c5cc(OC)ccc5[nH]c4cc3c(=O)c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,9-dimethoxyquinacridone |
| 2,9-dimethylquinacridone |
| 2,9-Dimethoxy-5,12-dihydroquino[2,3-b]acridine-7,14-dione |