ethyl 2-(hydroxy-diphenyl-methyl)piperidine-1-carboxylate structure
|
Common Name | ethyl 2-(hydroxy-diphenyl-methyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 21901-79-1 | Molecular Weight | 339.42800 | |
| Density | 1.164g/cm3 | Boiling Point | 492.6ºC at 760 mmHg | |
| Molecular Formula | C21H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.7ºC | |
| Name | ethyl 2-[hydroxy(diphenyl)methyl]piperidine-1-carboxylate |
|---|
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 492.6ºC at 760 mmHg |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.42800 |
| Flash Point | 251.7ºC |
| Exact Mass | 339.18300 |
| PSA | 49.77000 |
| LogP | 3.87140 |
| Vapour Pressure | 1.61E-10mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | PXKYXWKGNPYGEP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCCCC1C(O)(c1ccccc1)c1ccccc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |