2H-Indol-2-one,3,3'-(2-oxo-1,3-propanediylidene)bis[1,3-dihydro- (9CI) structure
|
Common Name | 2H-Indol-2-one,3,3'-(2-oxo-1,3-propanediylidene)bis[1,3-dihydro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 21905-77-1 | Molecular Weight | 316.31000 | |
| Density | 1.516g/cm3 | Boiling Point | 648ºC at 760mmHg | |
| Molecular Formula | C19H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.4ºC | |
| Name | (3E)-3-[(3Z)-2-oxo-3-(2-oxo-1H-indol-3-ylidene)propylidene]-1H-indol-2-one |
|---|
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 648ºC at 760mmHg |
| Molecular Formula | C19H12N2O3 |
| Molecular Weight | 316.31000 |
| Flash Point | 256.4ºC |
| Exact Mass | 316.08500 |
| PSA | 75.27000 |
| LogP | 2.90290 |
| Vapour Pressure | 1.12E-16mmHg at 25°C |
| Index of Refraction | 1.806 |
| InChIKey | VBCWZUFGYNWZTE-RRFADNKVSA-N |
| SMILES | O=C(C=C1C(=O)Nc2ccccc21)C=C1C(=O)Nc2ccccc21 |
| HS Code | 2933790090 |
|---|
|
~76%
2H-Indol-2-one,... CAS#:21905-77-1 |
| Literature: Popp; Parson; Donigan Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 10 p. 1235 - 1237 |
|
~%
2H-Indol-2-one,... CAS#:21905-77-1 |
| Literature: Popp; Parson; Donigan Journal of Pharmaceutical Sciences, 1980 , vol. 69, # 10 p. 1235 - 1237 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |