Cinnoline, 3-nitro- structure
|
Common Name | Cinnoline, 3-nitro- | ||
|---|---|---|---|---|
| CAS Number | 21905-82-8 | Molecular Weight | 175.14400 | |
| Density | 1.437g/cm3 | Boiling Point | 368.8ºC at 760 mmHg | |
| Molecular Formula | C8H5N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.8ºC | |
| Name | 3-nitrocinnoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.437g/cm3 |
|---|---|
| Boiling Point | 368.8ºC at 760 mmHg |
| Molecular Formula | C8H5N3O2 |
| Molecular Weight | 175.14400 |
| Flash Point | 176.8ºC |
| Exact Mass | 175.03800 |
| PSA | 71.60000 |
| LogP | 2.06120 |
| Vapour Pressure | 2.64E-05mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | HYZQJOVSKFXLGC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2ccccc2nn1 |
| HS Code | 2933990090 |
|---|
|
~%
Cinnoline, 3-nitro- CAS#:21905-82-8 |
| Literature: Baumgarten et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 1977,1979 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Cinnoline,3-nitro |
| 3-Nitro-cinnolin |
| 3-nitro-cinnoline |