Antimony,trichlorodiphenyl structure
|
Common Name | Antimony,trichlorodiphenyl | ||
|---|---|---|---|---|
| CAS Number | 21907-22-2 | Molecular Weight | 382.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10Cl3Sb | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Antimony trichloride, diphenyl |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10Cl3Sb |
|---|---|
| Molecular Weight | 382.32700 |
| Exact Mass | 379.88900 |
| LogP | 5.04210 |
| InChIKey | RTCULVFFPHSNLZ-UHFFFAOYSA-K |
| SMILES | Cl[Sb](Cl)(Cl)(c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| diphenyl antimony (3+),tris chloride |
| diphenylantimony(V) trichloride |
| diphenylantimony trichloride |
| Diphenyl-antimon(3+),Trichlorid |
| Diphenyl-antimon(3+),Tris-chlorid |
| Diphenylantimony dichloride |
| biphenylantimony trichloride |