4-[(4-benzylpiperazin-1-yl)methyl]-6-morpholin-4-yl-1,3,5-triazin-2-amine structure
|
Common Name | 4-[(4-benzylpiperazin-1-yl)methyl]-6-morpholin-4-yl-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 21921-65-3 | Molecular Weight | 369.46400 | |
| Density | 1.272g/cm3 | Boiling Point | 601.1ºC at 760 mmHg | |
| Molecular Formula | C19H27N7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.3ºC | |
| Name | 4-[(4-benzylpiperazin-1-yl)methyl]-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 601.1ºC at 760 mmHg |
| Molecular Formula | C19H27N7O |
| Molecular Weight | 369.46400 |
| Flash Point | 317.3ºC |
| Exact Mass | 369.22800 |
| PSA | 84.37000 |
| LogP | 0.47910 |
| Vapour Pressure | 2.09E-14mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | LSUQGKZEYURBKF-UHFFFAOYSA-N |
| SMILES | Nc1nc(CN2CCN(Cc3ccccc3)CC2)nc(N2CCOCC2)n1 |
|
~%
4-[(4-benzylpip... CAS#:21921-65-3 |
| Literature: Das,P.C. et al. Indian Journal of Chemistry, 1968 , vol. 6, p. 691 - 693 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |