(1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride
Modify Date: 2026-07-04 12:45:02
(1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride structure
|
Common Name | (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2194844-51-2 | Molecular Weight | 246.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClF2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9ClF2N4 |
|---|---|
| Molecular Weight | 246.64 |
| InChIKey | SKRGCVHPSBNFPD-UHFFFAOYSA-N |
| SMILES | Cl.NCc1cn(-c2cccc(F)c2F)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride? |
| A: SMILES notation of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride is Cl.NCc1cn(-c2cccc(F)c2F)nn1. |
| Q: What is the molecular formula of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride? |
| A: Molecular formula of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride is C9H9ClF2N4. |
| Q: What is the CAS number of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride? |
| A: CAS number of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride is 2194844-51-2. |
| Q: What is the Chinese name of 2194844-51-2? |
| A: Chinese name of 2194844-51-2 is 2194844-51-2. |
| Q: What is the English name of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride? |
| A: The English name of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride is (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride. |
| Q: What is the InChIKey of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride? |
| A: InChIKey of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride is SKRGCVHPSBNFPD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride? |
| A: Molecular weight of (1-(2,3-difluorophenyl)-1H-1,2,3-triazol-4-yl)methanamine hydrochloride is 246.64. |