3,3',5,5'-tetrabromo[1,1'-biphenyl]-2,2'-diol structure
|
Common Name | 3,3',5,5'-tetrabromo[1,1'-biphenyl]-2,2'-diol | ||
|---|---|---|---|---|
| CAS Number | 21951-40-6 | Molecular Weight | 323.98700 | |
| Density | 1.624g/cm3 | Boiling Point | 406.2ºC at 760 mmHg | |
| Molecular Formula | C12H6Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | 2,4-dichloro-6-(3,5-dichloro-2-hydroxyphenyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.624g/cm3 |
|---|---|
| Boiling Point | 406.2ºC at 760 mmHg |
| Molecular Formula | C12H6Cl4O2 |
| Molecular Weight | 323.98700 |
| Flash Point | 199.4ºC |
| Exact Mass | 321.91200 |
| PSA | 40.46000 |
| LogP | 5.37840 |
| Vapour Pressure | 3.54E-07mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | NXBKBCZEXWIAML-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(Cl)cc1-c1cc(Cl)cc(Cl)c1O |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| EINECS 244-679-3 |
| 3,3',5,5'-tetrachloro-2,2'-hydroxy-1,1'-biphenyl |
| 4,4',6,6'-Tetrachloro-o,o'-biphenol |
| 3,3',5,5'-tetrachlorobiphenyl-2,2'-diol |
| 3.5.3'.5'-Tetrachlor-2.2'-dihydroxy-biphenyl |
| 3,5,3',5'-Tetrachlor-biphenyl-2,2'-diol |
| 3,5,3',5'-tetrachloro-biphenyl-2,2'-diol |