(S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole
Modify Date: 2026-07-14 20:51:50
(S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole structure
|
Common Name | (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole | ||
|---|---|---|---|---|
| CAS Number | 2195357-75-4 | Molecular Weight | 380.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13F5N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H13F5N2O |
|---|---|
| Molecular Weight | 380.3 |
| InChIKey | XYJPNQBXDWVGKC-UHFFFAOYSA-N |
| SMILES | CC1=NC(Cc2cn(-c3c(F)c(F)c(F)c(F)c3F)c3ccccc23)CO1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole? |
| A: CAS number of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole is 2195357-75-4. |
| Q: What is the molecular weight of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole? |
| A: Molecular weight of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole is 380.3. |
| Q: What is the Chinese name of 2195357-75-4? |
| A: Chinese name of 2195357-75-4 is 2195357-75-4. |
| Q: What is the InChIKey of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole? |
| A: InChIKey of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole is XYJPNQBXDWVGKC-UHFFFAOYSA-N. |
| Q: What is the English name of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole? |
| A: The English name of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole is (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole. |
| Q: What is the molecular formula of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole? |
| A: Molecular formula of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole is C19H13F5N2O. |
| Q: What is the SMILES notation of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole? |
| A: SMILES notation of (S)-2-methyl-4-((1-(perfluorophenyl)-1H-indol-3-yl)methyl)-4,5-dihydrooxazole is CC1=NC(Cc2cn(-c3c(F)c(F)c(F)c(F)c3F)c3ccccc23)CO1. |