(E)-2-((4-chlorophenyl)imino)-5-(3-nitrobenzyl)thiazolidin-4-one
Modify Date: 2025-11-04 14:31:20
(E)-2-((4-chlorophenyl)imino)-5-(3-nitrobenzyl)thiazolidin-4-one structure
|
Common Name | (E)-2-((4-chlorophenyl)imino)-5-(3-nitrobenzyl)thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 219554-84-4 | Molecular Weight | 361.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12ClN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-2-((4-chlorophenyl)imino)-5-(3-nitrobenzyl)thiazolidin-4-one |
|---|
| Molecular Formula | C16H12ClN3O3S |
|---|---|
| Molecular Weight | 361.8 |
| InChIKey | DPQWYLXGIKBTOQ-UHFFFAOYSA-N |
| SMILES | O=C1NC(=Nc2ccc(Cl)cc2)SC1Cc1cccc([N+](=O)[O-])c1 |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1