ethyl 2-[[2-hydroxy-3,5-bis(1-methylethyl)benzoyl]amino]benzoate structure
|
Common Name | ethyl 2-[[2-hydroxy-3,5-bis(1-methylethyl)benzoyl]amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 21958-34-9 | Molecular Weight | 369.45400 | |
| Density | 1.149g/cm3 | Boiling Point | 448.6ºC at 760mmHg | |
| Molecular Formula | C22H27NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | ethyl 2-[[2-hydroxy-3,5-di(propan-2-yl)benzoyl]amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.149g/cm3 |
|---|---|
| Boiling Point | 448.6ºC at 760mmHg |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.45400 |
| Flash Point | 225.1ºC |
| Exact Mass | 369.19400 |
| PSA | 79.12000 |
| LogP | 5.45200 |
| Vapour Pressure | 1.16E-08mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | YFKMEHAVSBMMIY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cc(C(C)C)cc(C(C)C)c1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 244-681-4 |