2-Amino-2-(3-carboxyphenyl)acetic acid
Modify Date: 2026-07-02 10:44:23
2-Amino-2-(3-carboxyphenyl)acetic acid structure
|
Common Name | 2-Amino-2-(3-carboxyphenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2196-57-8 | Molecular Weight | 195.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[amino(carboxy)methyl]benzoic acid |
|---|
| Molecular Formula | C9H9NO4 |
|---|---|
| Molecular Weight | 195.17200 |
| Exact Mass | 195.05300 |
| PSA | 100.62000 |
| LogP | 1.16950 |
| InChIKey | REEQCKHBOMHDKN-UHFFFAOYSA-N |
| SMILES | NC(C(=O)O)c1cccc(C(=O)O)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Name: Compound tested for binding affinity towards Ionotropic glutamate receptor kainate
Source: ChEMBL
Target: Glutamate receptor ionotropic, kainate 2
External Id: CHEMBL699775
|
|
Name: Displacement of [3H]CPP from N-methyl-D-aspartate glutamate receptor in rat brain mem...
Source: ChEMBL
Target: Glutamate receptor ionotropic, NMDA 3A
External Id: CHEMBL748106
|
Total 2, Current Page 1 of 1
1