(4-Chloro-phenyl)-dimethylamino-acetic acid HCl
Modify Date: 2026-07-15 14:50:07
(4-Chloro-phenyl)-dimethylamino-acetic acid HCl structure
|
Common Name | (4-Chloro-phenyl)-dimethylamino-acetic acid HCl | ||
|---|---|---|---|---|
| CAS Number | 2197410-54-9 | Molecular Weight | 250.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-Chloro-phenyl)-dimethylamino-acetic acid HCl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13Cl2NO2 |
|---|---|
| Molecular Weight | 250.12 |
| InChIKey | PEFOQUPNTVXZSH-UHFFFAOYSA-N |
| SMILES | CN(C)C(C(=O)O)c1ccc(Cl)cc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl? |
| A: SMILES notation of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl is CN(C)C(C(=O)O)c1ccc(Cl)cc1.Cl. |
| Q: What is the CAS number of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl? |
| A: CAS number of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl is 2197410-54-9. |
| Q: What is the InChIKey of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl? |
| A: InChIKey of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl is PEFOQUPNTVXZSH-UHFFFAOYSA-N. |
| Q: What is the molecular weight of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl? |
| A: Molecular weight of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl is 250.12. |
| Q: What is the molecular formula of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl? |
| A: Molecular formula of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl is C10H13Cl2NO2. |
| Q: What is the English name of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl? |
| A: The English name of (4-Chloro-phenyl)-dimethylamino-acetic acid HCl is (4-Chloro-phenyl)-dimethylamino-acetic acid HCl. |
| Q: What is the Chinese name of 2197410-54-9? |
| A: Chinese name of 2197410-54-9 is 2197410-54-9. |